C16H21N3O4S3 — CID 89236690
N-[5-[5-(acetamidomethyl)thiophen-2-yl]sulfonyl-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-2-yl]prop-2-enamide (PubChem CID 89236690) has the molecular formula C16H21N3O4S3 and a molecular weight of 415.56 g/mol. Its IUPAC name is N-[5-[5-(acetamidomethyl)thiophen-2-yl]sulfonyl-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-2-yl]prop-2-enamide.
| Compound Name | N-[5-[5-(acetamidomethyl)thiophen-2-yl]sulfonyl-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 89236690 |
| Molecular Formula | C16H21N3O4S3 |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | N-[5-[5-(acetamidomethyl)thiophen-2-yl]sulfonyl-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-2-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CC2CN(S(=O)(=O)c3ccc(CNC(C)=O)s3)CC2S1 |
| InChI | InChI=1S/C16H21N3O4S3/c1-3-14(21)18-15-6-11-8-19(9-13(11)25-15)26(22,23)16-5-4-12(24-16)7-17-10(2)20/h3-5,11,13,15H,1,6-9H2,2H3,(H,17,20)(H,18,21) |
| InChIKey | PKOHCEGRLYNHHC-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|