C25H26F3N3O4S2 — CID 89236696
4-[[2-(prop-2-enoylamino)-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]sulfonyl]-N-[2-[4-(trifluoromethyl)phenyl]ethyl]benzamide (PubChem CID 89236696) has the molecular formula C25H26F3N3O4S2 and a molecular weight of 553.63 g/mol. Its IUPAC name is 4-[[2-(prop-2-enoylamino)-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]sulfonyl]-N-[2-[4-(trifluoromethyl)phenyl]ethyl]benzamide.
| Compound Name | 4-[[2-(prop-2-enoylamino)-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]sulfonyl]-N-[2-[4-(trifluoromethyl)phenyl]ethyl]benzamide |
|---|---|
| PubChem CID | 89236696 |
| Molecular Formula | C25H26F3N3O4S2 |
| Molecular Weight | 553.63 g/mol |
| Exact Mass | 553.13 |
| IUPAC Name | 4-[[2-(prop-2-enoylamino)-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]sulfonyl]-N-[2-[4-(trifluoromethyl)phenyl]ethyl]benzamide |
| SMILES | C=CC(=O)NC1CC2CN(S(=O)(=O)c3ccc(C(=O)NCCc4ccc(C(F)(F)F)cc4)cc3)CC2S1 |
| InChI | InChI=1S/C25H26F3N3O4S2/c1-2-22(32)30-23-13-18-14-31(15-21(18)36-23)37(34,35)20-9-5-17(6-10-20)24(33)29-12-11-16-3-7-19(8-4-16)25(26,27)28/h2-10,18,21,23H,1,11-15H2,(H,29,33)(H,30,32) |
| InChIKey | BDZSLFIOFHUCJM-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.63 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|