C24H22FN3O4S2 — CID 89237093
2-fluoro-N-(2-phenylethyl)-4-[[2-(prop-2-enoylamino)-4,6-dihydrothieno[2,3-c]pyrrol-5-yl]sulfonyl]benzamide (PubChem CID 89237093) has the molecular formula C24H22FN3O4S2 and a molecular weight of 499.59 g/mol. Its IUPAC name is 2-fluoro-N-(2-phenylethyl)-4-[[2-(prop-2-enoylamino)-4,6-dihydrothieno[2,3-c]pyrrol-5-yl]sulfonyl]benzamide.
| Compound Name | 2-fluoro-N-(2-phenylethyl)-4-[[2-(prop-2-enoylamino)-4,6-dihydrothieno[2,3-c]pyrrol-5-yl]sulfonyl]benzamide |
|---|---|
| PubChem CID | 89237093 |
| Molecular Formula | C24H22FN3O4S2 |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.10 |
| IUPAC Name | 2-fluoro-N-(2-phenylethyl)-4-[[2-(prop-2-enoylamino)-4,6-dihydrothieno[2,3-c]pyrrol-5-yl]sulfonyl]benzamide |
| SMILES | C=CC(=O)Nc1cc2c(s1)CN(S(=O)(=O)c1ccc(C(=O)NCCc3ccccc3)c(F)c1)C2 |
| InChI | InChI=1S/C24H22FN3O4S2/c1-2-22(29)27-23-12-17-14-28(15-21(17)33-23)34(31,32)18-8-9-19(20(25)13-18)24(30)26-11-10-16-6-4-3-5-7-16/h2-9,12-13H,1,10-11,14-15H2,(H,26,30)(H,27,29) |
| InChIKey | UYXFVWJJSBZLMD-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|