C24H24F3N3O4S2 — CID 89237993
4-[[2-(prop-2-enoylamino)-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]sulfonyl]-N-[[4-(trifluoromethyl)phenyl]methyl]benzamide (PubChem CID 89237993) has the molecular formula C24H24F3N3O4S2 and a molecular weight of 539.60 g/mol. Its IUPAC name is 4-[[2-(prop-2-enoylamino)-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]sulfonyl]-N-[[4-(trifluoromethyl)phenyl]methyl]benzamide.
| Compound Name | 4-[[2-(prop-2-enoylamino)-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]sulfonyl]-N-[[4-(trifluoromethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 89237993 |
| Molecular Formula | C24H24F3N3O4S2 |
| Molecular Weight | 539.60 g/mol |
| Exact Mass | 539.12 |
| IUPAC Name | 4-[[2-(prop-2-enoylamino)-2,3,3a,4,6,6a-hexahydrothieno[2,3-c]pyrrol-5-yl]sulfonyl]-N-[[4-(trifluoromethyl)phenyl]methyl]benzamide |
| SMILES | C=CC(=O)NC1CC2CN(S(=O)(=O)c3ccc(C(=O)NCc4ccc(C(F)(F)F)cc4)cc3)CC2S1 |
| InChI | InChI=1S/C24H24F3N3O4S2/c1-2-21(31)29-22-11-17-13-30(14-20(17)35-22)36(33,34)19-9-5-16(6-10-19)23(32)28-12-15-3-7-18(8-4-15)24(25,26)27/h2-10,17,20,22H,1,11-14H2,(H,28,32)(H,29,31) |
| InChIKey | FLUAULYGJGFVNZ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.60 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|