C19H17N3O4S2 — CID 89238402
N-[5-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)sulfonyl]-4,6-dihydrofuro[2,3-c]pyrrol-2-yl]prop-2-enamide (PubChem CID 89238402) has the molecular formula C19H17N3O4S2 and a molecular weight of 415.50 g/mol. Its IUPAC name is N-[5-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)sulfonyl]-4,6-dihydrofuro[2,3-c]pyrrol-2-yl]prop-2-enamide.
| Compound Name | N-[5-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)sulfonyl]-4,6-dihydrofuro[2,3-c]pyrrol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 89238402 |
| Molecular Formula | C19H17N3O4S2 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | N-[5-[(4-methyl-2-phenyl-1,3-thiazol-5-yl)sulfonyl]-4,6-dihydrofuro[2,3-c]pyrrol-2-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc2c(o1)CN(S(=O)(=O)c1sc(-c3ccccc3)nc1C)C2 |
| InChI | InChI=1S/C19H17N3O4S2/c1-3-16(23)21-17-9-14-10-22(11-15(14)26-17)28(24,25)19-12(2)20-18(27-19)13-7-5-4-6-8-13/h3-9H,1,10-11H2,2H3,(H,21,23) |
| InChIKey | HHOLVDOKNMCNCN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|