C19H17N3O5S — CID 89238487
N-[1-[5-(1,2-oxazol-5-yl)furan-2-yl]sulfonyl-3,4-dihydro-2H-quinolin-4-yl]prop-2-enamide (PubChem CID 89238487) has the molecular formula C19H17N3O5S and a molecular weight of 399.43 g/mol. Its IUPAC name is N-[1-[5-(1,2-oxazol-5-yl)furan-2-yl]sulfonyl-3,4-dihydro-2H-quinolin-4-yl]prop-2-enamide.
| Compound Name | N-[1-[5-(1,2-oxazol-5-yl)furan-2-yl]sulfonyl-3,4-dihydro-2H-quinolin-4-yl]prop-2-enamide |
|---|---|
| PubChem CID | 89238487 |
| Molecular Formula | C19H17N3O5S |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | N-[1-[5-(1,2-oxazol-5-yl)furan-2-yl]sulfonyl-3,4-dihydro-2H-quinolin-4-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CCN(S(=O)(=O)c2ccc(-c3ccno3)o2)c2ccccc21 |
| InChI | InChI=1S/C19H17N3O5S/c1-2-18(23)21-14-10-12-22(15-6-4-3-5-13(14)15)28(24,25)19-8-7-16(26-19)17-9-11-20-27-17/h2-9,11,14H,1,10,12H2,(H,21,23) |
| InChIKey | SFPGJDOVTMNJQA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 105.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|