C19H16O6S — CID 89239519
8-[(4-methoxycarbonylphenyl)methoxy]naphthalene-1-sulfonic acid (PubChem CID 89239519) has the molecular formula C19H16O6S and a molecular weight of 372.40 g/mol. Its IUPAC name is 8-[(4-methoxycarbonylphenyl)methoxy]naphthalene-1-sulfonic acid.
| Compound Name | 8-[(4-methoxycarbonylphenyl)methoxy]naphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 89239519 |
| Molecular Formula | C19H16O6S |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | 8-[(4-methoxycarbonylphenyl)methoxy]naphthalene-1-sulfonic acid |
| SMILES | COC(=O)c1ccc(COc2cccc3cccc(S(=O)(=O)O)c23)cc1 |
| InChI | InChI=1S/C19H16O6S/c1-24-19(20)15-10-8-13(9-11-15)12-25-16-6-2-4-14-5-3-7-17(18(14)16)26(21,22)23/h2-11H,12H2,1H3,(H,21,22,23) |
| InChIKey | ZGCQLHFFMVOZMH-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|