About 3-bromo-6-methylidene-8,9-dihydro-7H-benzo[7]annulen-5-one
3-bromo-6-methylidene-8,9-dihydro-7H-benzo[7]annulen-5-one (PubChem CID 89239604) has the molecular formula C12H11BrO
and a molecular weight of 251.12 g/mol. Its IUPAC name is 3-bromo-6-methylidene-8,9-dihydro-7H-benzo[7]annulen-5-one.
Molecular Properties
| Compound Name | 3-bromo-6-methylidene-8,9-dihydro-7H-benzo[7]annulen-5-one |
| PubChem CID | 89239604 |
| Molecular Formula | C12H11BrO |
| Molecular Weight | 251.12 g/mol |
| Exact Mass | 250.00 |
| IUPAC Name | 3-bromo-6-methylidene-8,9-dihydro-7H-benzo[7]annulen-5-one |
| SMILES | C=C1CCCc2ccc(Br)cc2C1=O |
| InChI | InChI=1S/C12H11BrO/c1-8-3-2-4-9-5-6-10(13)7-11(9)12(8)14/h5-7H,1-4H2 |
| InChIKey | QUWXSXFTJKXKIN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.12 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-6-methylidene-8,9-dihydro-7H-benzo[7]annulen-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-6-methylidene-8,9-dihydro-7H-benzo[7]annulen-5-one?
The IUPAC name of 3-bromo-6-methylidene-8,9-dihydro-7H-benzo[7]annulen-5-one (CID 89239604) is 3-bromo-6-methylidene-8,9-dihydro-7H-benzo[7]annulen-5-one.
What is the SMILES notation for 3-bromo-6-methylidene-8,9-dihydro-7H-benzo[7]annulen-5-one?
The canonical SMILES for 3-bromo-6-methylidene-8,9-dihydro-7H-benzo[7]annulen-5-one is C=C1CCCc2ccc(Br)cc2C1=O.
What is the InChIKey of 3-bromo-6-methylidene-8,9-dihydro-7H-benzo[7]annulen-5-one?
The InChIKey is QUWXSXFTJKXKIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11BrO/c1-8-3-2-4-9-5-6-10(13)7-11(9)12(8)14/h5-7H,1-4H2.
What are the key properties of 3-bromo-6-methylidene-8,9-dihydro-7H-benzo[7]annulen-5-one?
3-bromo-6-methylidene-8,9-dihydro-7H-benzo[7]annulen-5-one has a molecular weight of 251.12 g/mol, XLogP of 3.52, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-6-methylidene-8,9-dihydro-7H-benzo[7]annulen-5-one is sourced from PubChem (CID 89239604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).