C7H10N4O2 — CID 89239855
7-methyl-4a,5,6,7-tetrahydro-1H-pteridine-2,4-dione (PubChem CID 89239855) has the molecular formula C7H10N4O2 and a molecular weight of 182.18 g/mol. Its IUPAC name is 7-methyl-4a,5,6,7-tetrahydro-1H-pteridine-2,4-dione.
| Compound Name | 7-methyl-4a,5,6,7-tetrahydro-1H-pteridine-2,4-dione |
|---|---|
| PubChem CID | 89239855 |
| Molecular Formula | C7H10N4O2 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | 7-methyl-4a,5,6,7-tetrahydro-1H-pteridine-2,4-dione |
| SMILES | CC1CNC2C(=O)NC(=O)NC2=N1 |
| InChI | InChI=1S/C7H10N4O2/c1-3-2-8-4-5(9-3)10-7(13)11-6(4)12/h3-4,8H,2H2,1H3,(H2,9,10,11,12,13) |
| InChIKey | AGDGNFIKIWEYDF-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |