C17H16F6O6S — CID 89239979
ethyl 2-[1-oxo-2-(2,2,2-trifluoroethyl)-6-(trifluoromethylsulfonyloxy)-3,4-dihydronaphthalen-2-yl]acetate (PubChem CID 89239979) has the molecular formula C17H16F6O6S and a molecular weight of 462.36 g/mol. Its IUPAC name is ethyl 2-[1-oxo-2-(2,2,2-trifluoroethyl)-6-(trifluoromethylsulfonyloxy)-3,4-dihydronaphthalen-2-yl]acetate.
| Compound Name | ethyl 2-[1-oxo-2-(2,2,2-trifluoroethyl)-6-(trifluoromethylsulfonyloxy)-3,4-dihydronaphthalen-2-yl]acetate |
|---|---|
| PubChem CID | 89239979 |
| Molecular Formula | C17H16F6O6S |
| Molecular Weight | 462.36 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | ethyl 2-[1-oxo-2-(2,2,2-trifluoroethyl)-6-(trifluoromethylsulfonyloxy)-3,4-dihydronaphthalen-2-yl]acetate |
| SMILES | CCOC(=O)CC1(CC(F)(F)F)CCc2cc(OS(=O)(=O)C(F)(F)F)ccc2C1=O |
| InChI | InChI=1S/C17H16F6O6S/c1-2-28-13(24)8-15(9-16(18,19)20)6-5-10-7-11(3-4-12(10)14(15)25)29-30(26,27)17(21,22)23/h3-4,7H,2,5-6,8-9H2,1H3 |
| InChIKey | AACWHGXMZCJFDT-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.36 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|