C8H12N2O2 — CID 89240043
[(1R,2R)-2-cyanocyclohexyl]carbamic acid (PubChem CID 89240043) has the molecular formula C8H12N2O2 and a molecular weight of 168.20 g/mol. Its IUPAC name is [(1R,2R)-2-cyanocyclohexyl]carbamic acid.
| Compound Name | [(1R,2R)-2-cyanocyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 89240043 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | [(1R,2R)-2-cyanocyclohexyl]carbamic acid |
| SMILES | N#C[C@@H]1CCCC[C@H]1NC(=O)O |
| InChI | InChI=1S/C8H12N2O2/c9-5-6-3-1-2-4-7(6)10-8(11)12/h6-7,10H,1-4H2,(H,11,12)/t6-,7+/m0/s1 |
| InChIKey | SATMLSGQOOGQBP-NKWVEPMBSA-N |
| XLogP | 1.34 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |