C29H33N3O4S2 — CID 89240340
N-[[3-[4-ethoxy-3-[[(2R)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]sulfamoyl]-5-methylphenyl]phenyl]methyl]ethanethioamide (PubChem CID 89240340) has the molecular formula C29H33N3O4S2 and a molecular weight of 551.73 g/mol. Its IUPAC name is N-[[3-[4-ethoxy-3-[[(2R)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]sulfamoyl]-5-methylphenyl]phenyl]methyl]ethanethioamide.
| Compound Name | N-[[3-[4-ethoxy-3-[[(2R)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]sulfamoyl]-5-methylphenyl]phenyl]methyl]ethanethioamide |
|---|---|
| PubChem CID | 89240340 |
| Molecular Formula | C29H33N3O4S2 |
| Molecular Weight | 551.73 g/mol |
| Exact Mass | 551.19 |
| IUPAC Name | N-[[3-[4-ethoxy-3-[[(2R)-1-hydroxy-3-(1H-indol-3-yl)propan-2-yl]sulfamoyl]-5-methylphenyl]phenyl]methyl]ethanethioamide |
| SMILES | CCOc1c(C)cc(-c2cccc(CNC(C)=S)c2)cc1S(=O)(=O)N[C@@H](CO)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C29H33N3O4S2/c1-4-36-29-19(2)12-23(22-9-7-8-21(13-22)16-30-20(3)37)15-28(29)38(34,35)32-25(18-33)14-24-17-31-27-11-6-5-10-26(24)27/h5-13,15,17,25,31-33H,4,14,16,18H2,1-3H3,(H,30,37)/t25-/m1/s1 |
| InChIKey | NVZJZWMYONYWFP-RUZDIDTESA-N |
| XLogP | 4.86 |
| TPSA | 103.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.73 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|