About N-[3-(aminomethyl)cyclohexa-1,5-dien-1-yl]formamide
N-[3-(aminomethyl)cyclohexa-1,5-dien-1-yl]formamide (PubChem CID 89240366) has the molecular formula C8H12N2O
and a molecular weight of 152.20 g/mol. Its IUPAC name is N-[3-(aminomethyl)cyclohexa-1,5-dien-1-yl]formamide.
Molecular Properties
| Compound Name | N-[3-(aminomethyl)cyclohexa-1,5-dien-1-yl]formamide |
| PubChem CID | 89240366 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | N-[3-(aminomethyl)cyclohexa-1,5-dien-1-yl]formamide |
| SMILES | NCC1C=C(NC=O)C=CC1 |
| InChI | InChI=1S/C8H12N2O/c9-5-7-2-1-3-8(4-7)10-6-11/h1,3-4,6-7H,2,5,9H2,(H,10,11) |
| InChIKey | UAGKIECJCCKOEL-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(aminomethyl)cyclohexa-1,5-dien-1-yl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(aminomethyl)cyclohexa-1,5-dien-1-yl]formamide?
The IUPAC name of N-[3-(aminomethyl)cyclohexa-1,5-dien-1-yl]formamide (CID 89240366) is N-[3-(aminomethyl)cyclohexa-1,5-dien-1-yl]formamide.
What is the SMILES notation for N-[3-(aminomethyl)cyclohexa-1,5-dien-1-yl]formamide?
The canonical SMILES for N-[3-(aminomethyl)cyclohexa-1,5-dien-1-yl]formamide is NCC1C=C(NC=O)C=CC1.
What is the InChIKey of N-[3-(aminomethyl)cyclohexa-1,5-dien-1-yl]formamide?
The InChIKey is UAGKIECJCCKOEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O/c9-5-7-2-1-3-8(4-7)10-6-11/h1,3-4,6-7H,2,5,9H2,(H,10,11).
What are the key properties of N-[3-(aminomethyl)cyclohexa-1,5-dien-1-yl]formamide?
N-[3-(aminomethyl)cyclohexa-1,5-dien-1-yl]formamide has a molecular weight of 152.20 g/mol, XLogP of 0.15, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(aminomethyl)cyclohexa-1,5-dien-1-yl]formamide is sourced from PubChem (CID 89240366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).