C48H102N10O3 — CID 89240371
4-(1-aminoethylamino)-N-[2-[bis[2-[[7-(2-aminobutan-2-ylamino)-3,5,5,7-tetramethyl-4-oxooctan-3-yl]amino]ethyl]amino]ethyl]-2,2,4-trimethylpentanamide (PubChem CID 89240371) has the molecular formula C48H102N10O3 and a molecular weight of 867.41 g/mol. Its IUPAC name is 4-(1-aminoethylamino)-N-[2-[bis[2-[[7-(2-aminobutan-2-ylamino)-3,5,5,7-tetramethyl-4-oxooctan-3-yl]amino]ethyl]amino]ethyl]-2,2,4-trimethylpentanamide.
| Compound Name | 4-(1-aminoethylamino)-N-[2-[bis[2-[[7-(2-aminobutan-2-ylamino)-3,5,5,7-tetramethyl-4-oxooctan-3-yl]amino]ethyl]amino]ethyl]-2,2,4-trimethylpentanamide |
|---|---|
| PubChem CID | 89240371 |
| Molecular Formula | C48H102N10O3 |
| Molecular Weight | 867.41 g/mol |
| Exact Mass | 866.81 |
| IUPAC Name | 4-(1-aminoethylamino)-N-[2-[bis[2-[[7-(2-aminobutan-2-ylamino)-3,5,5,7-tetramethyl-4-oxooctan-3-yl]amino]ethyl]amino]ethyl]-2,2,4-trimethylpentanamide |
| SMILES | CCC(C)(N)NC(C)(C)CC(C)(C)C(=O)C(C)(CC)NCCN(CCNC(=O)C(C)(C)CC(C)(C)NC(C)N)CCNC(C)(CC)C(=O)C(C)(C)CC(C)(C)NC(C)(N)CC |
| InChI | InChI=1S/C48H102N10O3/c1-22-45(18,36(59)39(6,7)32-43(14,15)56-47(20,50)24-3)53-27-30-58(29-26-52-38(61)41(10,11)34-42(12,13)55-35(5)49)31-28-54-46(19,23-2)37(60)40(8,9)33-44(16,17)57-48(21,51)25-4/h35,53-57H,22-34,49-51H2,1-21H3,(H,52,61) |
| InChIKey | VPFDGYQDFOKPFJ-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 204.69 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 61 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.41 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|