About fluoro 3-fluoro-2,4-dioxobut-3-enoate
fluoro 3-fluoro-2,4-dioxobut-3-enoate (PubChem CID 89240415) has the molecular formula C4F2O4
and a molecular weight of 150.04 g/mol. Its IUPAC name is fluoro 3-fluoro-2,4-dioxobut-3-enoate.
Molecular Properties
| Compound Name | fluoro 3-fluoro-2,4-dioxobut-3-enoate |
| PubChem CID | 89240415 |
| Molecular Formula | C4F2O4 |
| Molecular Weight | 150.04 g/mol |
| Exact Mass | 149.98 |
| IUPAC Name | fluoro 3-fluoro-2,4-dioxobut-3-enoate |
| SMILES | O=C=C(F)C(=O)C(=O)OF |
| InChI | InChI=1S/C4F2O4/c5-2(1-7)3(8)4(9)10-6 |
| InChIKey | AKWBPNQTOGSWMT-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.04 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze fluoro 3-fluoro-2,4-dioxobut-3-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoro 3-fluoro-2,4-dioxobut-3-enoate?
The IUPAC name of fluoro 3-fluoro-2,4-dioxobut-3-enoate (CID 89240415) is fluoro 3-fluoro-2,4-dioxobut-3-enoate.
What is the SMILES notation for fluoro 3-fluoro-2,4-dioxobut-3-enoate?
The canonical SMILES for fluoro 3-fluoro-2,4-dioxobut-3-enoate is O=C=C(F)C(=O)C(=O)OF.
What is the InChIKey of fluoro 3-fluoro-2,4-dioxobut-3-enoate?
The InChIKey is AKWBPNQTOGSWMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4F2O4/c5-2(1-7)3(8)4(9)10-6.
What are the key properties of fluoro 3-fluoro-2,4-dioxobut-3-enoate?
fluoro 3-fluoro-2,4-dioxobut-3-enoate has a molecular weight of 150.04 g/mol, XLogP of -0.33, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for fluoro 3-fluoro-2,4-dioxobut-3-enoate is sourced from PubChem (CID 89240415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).