C12H21NO — CID 89240453
(3E,5Z,7E)-5-methoxy-6,7-dimethylnona-3,5,7-trien-3-amine (PubChem CID 89240453) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is (3E,5Z,7E)-5-methoxy-6,7-dimethylnona-3,5,7-trien-3-amine.
| Compound Name | (3E,5Z,7E)-5-methoxy-6,7-dimethylnona-3,5,7-trien-3-amine |
|---|---|
| PubChem CID | 89240453 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | (3E,5Z,7E)-5-methoxy-6,7-dimethylnona-3,5,7-trien-3-amine |
| SMILES | C/C=C(C)/C(C)=C(/C=C(/N)CC)OC |
| InChI | InChI=1S/C12H21NO/c1-6-9(3)10(4)12(14-5)8-11(13)7-2/h6,8H,7,13H2,1-5H3/b9-6+,11-8+,12-10- |
| InChIKey | FTSPSYHUJLPDDQ-JRAIHIJKSA-N |
| XLogP | 3.13 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|