About N-[(2S)-2-cyclohexa-2,4-dien-1-yl-2-ethenoxyethyl]-N-propan-2-ylpropan-1-amine
N-[(2S)-2-cyclohexa-2,4-dien-1-yl-2-ethenoxyethyl]-N-propan-2-ylpropan-1-amine (PubChem CID 89240463) has the molecular formula C16H27NO
and a molecular weight of 249.40 g/mol. Its IUPAC name is N-[(2S)-2-cyclohexa-2,4-dien-1-yl-2-ethenoxyethyl]-N-propan-2-ylpropan-1-amine.
Molecular Properties
| Compound Name | N-[(2S)-2-cyclohexa-2,4-dien-1-yl-2-ethenoxyethyl]-N-propan-2-ylpropan-1-amine |
| PubChem CID | 89240463 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | N-[(2S)-2-cyclohexa-2,4-dien-1-yl-2-ethenoxyethyl]-N-propan-2-ylpropan-1-amine |
| SMILES | C=CO[C@H](CN(CCC)C(C)C)C1C=CC=CC1 |
| InChI | InChI=1S/C16H27NO/c1-5-12-17(14(3)4)13-16(18-6-2)15-10-8-7-9-11-15/h6-10,14-16H,2,5,11-13H2,1,3-4H3/t15?,16-/m1/s1 |
| InChIKey | SRICEXBEXJEQPV-OEMAIJDKSA-N |
| XLogP | 3.77 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze N-[(2S)-2-cyclohexa-2,4-dien-1-yl-2-ethenoxyethyl]-N-propan-2-ylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S)-2-cyclohexa-2,4-dien-1-yl-2-ethenoxyethyl]-N-propan-2-ylpropan-1-amine?
The IUPAC name of N-[(2S)-2-cyclohexa-2,4-dien-1-yl-2-ethenoxyethyl]-N-propan-2-ylpropan-1-amine (CID 89240463) is N-[(2S)-2-cyclohexa-2,4-dien-1-yl-2-ethenoxyethyl]-N-propan-2-ylpropan-1-amine.
What is the SMILES notation for N-[(2S)-2-cyclohexa-2,4-dien-1-yl-2-ethenoxyethyl]-N-propan-2-ylpropan-1-amine?
The canonical SMILES for N-[(2S)-2-cyclohexa-2,4-dien-1-yl-2-ethenoxyethyl]-N-propan-2-ylpropan-1-amine is C=CO[C@H](CN(CCC)C(C)C)C1C=CC=CC1.
What is the InChIKey of N-[(2S)-2-cyclohexa-2,4-dien-1-yl-2-ethenoxyethyl]-N-propan-2-ylpropan-1-amine?
The InChIKey is SRICEXBEXJEQPV-OEMAIJDKSA-N. The full InChI is InChI=1S/C16H27NO/c1-5-12-17(14(3)4)13-16(18-6-2)15-10-8-7-9-11-15/h6-10,14-16H,2,5,11-13H2,1,3-4H3/t15?,16-/m1/s1.
What are the key properties of N-[(2S)-2-cyclohexa-2,4-dien-1-yl-2-ethenoxyethyl]-N-propan-2-ylpropan-1-amine?
N-[(2S)-2-cyclohexa-2,4-dien-1-yl-2-ethenoxyethyl]-N-propan-2-ylpropan-1-amine has a molecular weight of 249.40 g/mol, XLogP of 3.77, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S)-2-cyclohexa-2,4-dien-1-yl-2-ethenoxyethyl]-N-propan-2-ylpropan-1-amine is sourced from PubChem (CID 89240463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).