About 2,3-bis(hydroxymethyl)-4,5,6-trimethylphenol
2,3-bis(hydroxymethyl)-4,5,6-trimethylphenol (PubChem CID 89240723) has the molecular formula C11H16O3
and a molecular weight of 196.25 g/mol. Its IUPAC name is 2,3-bis(hydroxymethyl)-4,5,6-trimethylphenol.
Molecular Properties
| Compound Name | 2,3-bis(hydroxymethyl)-4,5,6-trimethylphenol |
| PubChem CID | 89240723 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 2,3-bis(hydroxymethyl)-4,5,6-trimethylphenol |
| SMILES | Cc1c(C)c(O)c(CO)c(CO)c1C |
| InChI | InChI=1S/C11H16O3/c1-6-7(2)9(4-12)10(5-13)11(14)8(6)3/h12-14H,4-5H2,1-3H3 |
| InChIKey | OBESCHBJNSPFIJ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-bis(hydroxymethyl)-4,5,6-trimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis(hydroxymethyl)-4,5,6-trimethylphenol?
The IUPAC name of 2,3-bis(hydroxymethyl)-4,5,6-trimethylphenol (CID 89240723) is 2,3-bis(hydroxymethyl)-4,5,6-trimethylphenol.
What is the SMILES notation for 2,3-bis(hydroxymethyl)-4,5,6-trimethylphenol?
The canonical SMILES for 2,3-bis(hydroxymethyl)-4,5,6-trimethylphenol is Cc1c(C)c(O)c(CO)c(CO)c1C.
What is the InChIKey of 2,3-bis(hydroxymethyl)-4,5,6-trimethylphenol?
The InChIKey is OBESCHBJNSPFIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O3/c1-6-7(2)9(4-12)10(5-13)11(14)8(6)3/h12-14H,4-5H2,1-3H3.
What are the key properties of 2,3-bis(hydroxymethyl)-4,5,6-trimethylphenol?
2,3-bis(hydroxymethyl)-4,5,6-trimethylphenol has a molecular weight of 196.25 g/mol, XLogP of 1.30, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(hydroxymethyl)-4,5,6-trimethylphenol is sourced from PubChem (CID 89240723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).