About (2E)-N,N-dimethyl-3-(2-methylpyrimidin-4-yl)penta-2,4-dien-2-amine
(2E)-N,N-dimethyl-3-(2-methylpyrimidin-4-yl)penta-2,4-dien-2-amine (PubChem CID 89240737) has the molecular formula C12H17N3
and a molecular weight of 203.29 g/mol. Its IUPAC name is (2E)-N,N-dimethyl-3-(2-methylpyrimidin-4-yl)penta-2,4-dien-2-amine.
Molecular Properties
| Compound Name | (2E)-N,N-dimethyl-3-(2-methylpyrimidin-4-yl)penta-2,4-dien-2-amine |
| PubChem CID | 89240737 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | (2E)-N,N-dimethyl-3-(2-methylpyrimidin-4-yl)penta-2,4-dien-2-amine |
| SMILES | C=C/C(=C(/C)N(C)C)c1ccnc(C)n1 |
| InChI | InChI=1S/C12H17N3/c1-6-11(9(2)15(4)5)12-7-8-13-10(3)14-12/h6-8H,1H2,2-5H3/b11-9+ |
| InChIKey | LEWZAGFNQSMTTI-PKNBQFBNSA-N |
| XLogP | 2.26 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-N,N-dimethyl-3-(2-methylpyrimidin-4-yl)penta-2,4-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-N,N-dimethyl-3-(2-methylpyrimidin-4-yl)penta-2,4-dien-2-amine?
The IUPAC name of (2E)-N,N-dimethyl-3-(2-methylpyrimidin-4-yl)penta-2,4-dien-2-amine (CID 89240737) is (2E)-N,N-dimethyl-3-(2-methylpyrimidin-4-yl)penta-2,4-dien-2-amine.
What is the SMILES notation for (2E)-N,N-dimethyl-3-(2-methylpyrimidin-4-yl)penta-2,4-dien-2-amine?
The canonical SMILES for (2E)-N,N-dimethyl-3-(2-methylpyrimidin-4-yl)penta-2,4-dien-2-amine is C=C/C(=C(/C)N(C)C)c1ccnc(C)n1.
What is the InChIKey of (2E)-N,N-dimethyl-3-(2-methylpyrimidin-4-yl)penta-2,4-dien-2-amine?
The InChIKey is LEWZAGFNQSMTTI-PKNBQFBNSA-N. The full InChI is InChI=1S/C12H17N3/c1-6-11(9(2)15(4)5)12-7-8-13-10(3)14-12/h6-8H,1H2,2-5H3/b11-9+.
What are the key properties of (2E)-N,N-dimethyl-3-(2-methylpyrimidin-4-yl)penta-2,4-dien-2-amine?
(2E)-N,N-dimethyl-3-(2-methylpyrimidin-4-yl)penta-2,4-dien-2-amine has a molecular weight of 203.29 g/mol, XLogP of 2.26, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-N,N-dimethyl-3-(2-methylpyrimidin-4-yl)penta-2,4-dien-2-amine is sourced from PubChem (CID 89240737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).