C6H10ClN3 — CID 89240750
(1E,3E)-4-chloro-1-N'-methyl-4-(methylideneamino)buta-1,3-diene-1,1-diamine (PubChem CID 89240750) has the molecular formula C6H10ClN3 and a molecular weight of 159.62 g/mol. Its IUPAC name is (1E,3E)-4-chloro-1-N'-methyl-4-(methylideneamino)buta-1,3-diene-1,1-diamine.
| Compound Name | (1E,3E)-4-chloro-1-N'-methyl-4-(methylideneamino)buta-1,3-diene-1,1-diamine |
|---|---|
| PubChem CID | 89240750 |
| Molecular Formula | C6H10ClN3 |
| Molecular Weight | 159.62 g/mol |
| Exact Mass | 159.06 |
| IUPAC Name | (1E,3E)-4-chloro-1-N'-methyl-4-(methylideneamino)buta-1,3-diene-1,1-diamine |
| SMILES | C=N/C(Cl)=C\C=C(/N)NC |
| InChI | InChI=1S/C6H10ClN3/c1-9-5(7)3-4-6(8)10-2/h3-4,10H,1,8H2,2H3/b5-3-,6-4+ |
| InChIKey | FJTJPMQNLVJKRI-CIIODKQPSA-N |
| XLogP | 0.79 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.62 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|