C13H21NO — CID 89240822
[4-[(2E,4Z)-hepta-2,4,6-trienyl]piperidin-1-yl]methanol (PubChem CID 89240822) has the molecular formula C13H21NO and a molecular weight of 207.32 g/mol. Its IUPAC name is [4-[(2E,4Z)-hepta-2,4,6-trienyl]piperidin-1-yl]methanol.
| Compound Name | [4-[(2E,4Z)-hepta-2,4,6-trienyl]piperidin-1-yl]methanol |
|---|---|
| PubChem CID | 89240822 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | [4-[(2E,4Z)-hepta-2,4,6-trienyl]piperidin-1-yl]methanol |
| SMILES | C=C/C=C\C=C\CC1CCN(CO)CC1 |
| InChI | InChI=1S/C13H21NO/c1-2-3-4-5-6-7-13-8-10-14(12-15)11-9-13/h2-6,13,15H,1,7-12H2/b4-3-,6-5+ |
| InChIKey | VGWQAACVYUUJQA-DNVGVPOPSA-N |
| XLogP | 2.34 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|