About 4-benzyl-N-(2,4-dimethylphenyl)piperazine-1-carbothioamide
4-benzyl-N-(2,4-dimethylphenyl)piperazine-1-carbothioamide (PubChem CID 892410) has the molecular formula C20H25N3S
and a molecular weight of 339.51 g/mol. Its IUPAC name is 4-benzyl-N-(2,4-dimethylphenyl)piperazine-1-carbothioamide.
Molecular Properties
| Compound Name | 4-benzyl-N-(2,4-dimethylphenyl)piperazine-1-carbothioamide |
| PubChem CID | 892410 |
| Molecular Formula | C20H25N3S |
| Molecular Weight | 339.51 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 4-benzyl-N-(2,4-dimethylphenyl)piperazine-1-carbothioamide |
| SMILES | Cc1ccc(NC(=S)N2CCN(Cc3ccccc3)CC2)c(C)c1 |
| InChI | InChI=1S/C20H25N3S/c1-16-8-9-19(17(2)14-16)21-20(24)23-12-10-22(11-13-23)15-18-6-4-3-5-7-18/h3-9,14H,10-13,15H2,1-2H3,(H,21,24) |
| InChIKey | BUBMOMNOVFVHTB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.51 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-benzyl-N-(2,4-dimethylphenyl)piperazine-1-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyl-N-(2,4-dimethylphenyl)piperazine-1-carbothioamide?
The IUPAC name of 4-benzyl-N-(2,4-dimethylphenyl)piperazine-1-carbothioamide (CID 892410) is 4-benzyl-N-(2,4-dimethylphenyl)piperazine-1-carbothioamide.
What is the SMILES notation for 4-benzyl-N-(2,4-dimethylphenyl)piperazine-1-carbothioamide?
The canonical SMILES for 4-benzyl-N-(2,4-dimethylphenyl)piperazine-1-carbothioamide is Cc1ccc(NC(=S)N2CCN(Cc3ccccc3)CC2)c(C)c1.
What is the InChIKey of 4-benzyl-N-(2,4-dimethylphenyl)piperazine-1-carbothioamide?
The InChIKey is BUBMOMNOVFVHTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25N3S/c1-16-8-9-19(17(2)14-16)21-20(24)23-12-10-22(11-13-23)15-18-6-4-3-5-7-18/h3-9,14H,10-13,15H2,1-2H3,(H,21,24).
What are the key properties of 4-benzyl-N-(2,4-dimethylphenyl)piperazine-1-carbothioamide?
4-benzyl-N-(2,4-dimethylphenyl)piperazine-1-carbothioamide has a molecular weight of 339.51 g/mol, XLogP of 3.82, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-N-(2,4-dimethylphenyl)piperazine-1-carbothioamide is sourced from PubChem (CID 892410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).