C26H38O7 — CID 89241012
(1R,3S,7S,8S,10S,15Z,18R)-7-hydroxy-12-[(E,1S)-1-hydroxy-4-methoxybut-2-enyl]-3-methyl-5-methylidene-9,13,22-trioxatricyclo[16.3.1.08,10]docosa-15,19-dien-14-one (PubChem CID 89241012) has the molecular formula C26H38O7 and a molecular weight of 462.58 g/mol. Its IUPAC name is (1R,3S,7S,8S,10S,15Z,18R)-7-hydroxy-12-[(E,1S)-1-hydroxy-4-methoxybut-2-enyl]-3-methyl-5-methylidene-9,13,22-trioxatricyclo[16.3.1.08,10]docosa-15,19-dien-14-one.
| Compound Name | (1R,3S,7S,8S,10S,15Z,18R)-7-hydroxy-12-[(E,1S)-1-hydroxy-4-methoxybut-2-enyl]-3-methyl-5-methylidene-9,13,22-trioxatricyclo[16.3.1.08,10]docosa-15,19-dien-14-one |
|---|---|
| PubChem CID | 89241012 |
| Molecular Formula | C26H38O7 |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | (1R,3S,7S,8S,10S,15Z,18R)-7-hydroxy-12-[(E,1S)-1-hydroxy-4-methoxybut-2-enyl]-3-methyl-5-methylidene-9,13,22-trioxatricyclo[16.3.1.08,10]docosa-15,19-dien-14-one |
| SMILES | C=C1C[C@H](C)C[C@@H]2CC=C[C@@H](C/C=C/C(=O)OC([C@@H](O)/C=C/COC)C[C@@H]3O[C@H]3[C@@H](O)C1)O2 |
| InChI | InChI=1S/C26H38O7/c1-17-13-18(2)15-22(28)26-24(33-26)16-23(21(27)10-6-12-30-3)32-25(29)11-5-8-19-7-4-9-20(14-17)31-19/h4-7,10-11,17,19-24,26-28H,2,8-9,12-16H2,1,3H3/b10-6+,11-5+/t17-,19-,20-,21-,22-,23?,24-,26-/m0/s1 |
| InChIKey | JSRMLTPGVQJWSV-YBJDWJJCSA-N |
| XLogP | 3.02 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|