About 4a-methyl-6,8a-dihydro-5H-quinoline
4a-methyl-6,8a-dihydro-5H-quinoline (PubChem CID 89241057) has the molecular formula C10H13N
and a molecular weight of 147.22 g/mol. Its IUPAC name is 4a-methyl-6,8a-dihydro-5H-quinoline.
Molecular Properties
| Compound Name | 4a-methyl-6,8a-dihydro-5H-quinoline |
| PubChem CID | 89241057 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | 4a-methyl-6,8a-dihydro-5H-quinoline |
| SMILES | CC12C=CC=NC1C=CCC2 |
| InChI | InChI=1S/C10H13N/c1-10-6-3-2-5-9(10)11-8-4-7-10/h2,4-5,7-9H,3,6H2,1H3 |
| InChIKey | DDTPISVLBYLYNQ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4a-methyl-6,8a-dihydro-5H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4a-methyl-6,8a-dihydro-5H-quinoline?
The IUPAC name of 4a-methyl-6,8a-dihydro-5H-quinoline (CID 89241057) is 4a-methyl-6,8a-dihydro-5H-quinoline.
What is the SMILES notation for 4a-methyl-6,8a-dihydro-5H-quinoline?
The canonical SMILES for 4a-methyl-6,8a-dihydro-5H-quinoline is CC12C=CC=NC1C=CCC2.
What is the InChIKey of 4a-methyl-6,8a-dihydro-5H-quinoline?
The InChIKey is DDTPISVLBYLYNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N/c1-10-6-3-2-5-9(10)11-8-4-7-10/h2,4-5,7-9H,3,6H2,1H3.
What are the key properties of 4a-methyl-6,8a-dihydro-5H-quinoline?
4a-methyl-6,8a-dihydro-5H-quinoline has a molecular weight of 147.22 g/mol, XLogP of 2.35, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4a-methyl-6,8a-dihydro-5H-quinoline is sourced from PubChem (CID 89241057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).