C23H26N6O — CID 89241131
N-[3-[(7-cyclobutyl-3-phenyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)amino]-2,2-dimethylpropyl]prop-2-ynamide (PubChem CID 89241131) has the molecular formula C23H26N6O and a molecular weight of 402.50 g/mol. Its IUPAC name is N-[3-[(7-cyclobutyl-3-phenyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)amino]-2,2-dimethylpropyl]prop-2-ynamide.
| Compound Name | N-[3-[(7-cyclobutyl-3-phenyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)amino]-2,2-dimethylpropyl]prop-2-ynamide |
|---|---|
| PubChem CID | 89241131 |
| Molecular Formula | C23H26N6O |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | N-[3-[(7-cyclobutyl-3-phenyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)amino]-2,2-dimethylpropyl]prop-2-ynamide |
| SMILES | C#CC(=O)NCC(C)(C)CNc1nn2c(-c3ccccc3)nnc2cc1C1CCC1 |
| InChI | InChI=1S/C23H26N6O/c1-4-20(30)24-14-23(2,3)15-25-21-18(16-11-8-12-16)13-19-26-27-22(29(19)28-21)17-9-6-5-7-10-17/h1,5-7,9-10,13,16H,8,11-12,14-15H2,2-3H3,(H,24,30)(H,25,28) |
| InChIKey | BXAAOKWELGSDAR-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 84.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|