About N-[amino(methyl)amino]-N'-methylmethanimidamide
N-[amino(methyl)amino]-N'-methylmethanimidamide (PubChem CID 89241224) has the molecular formula C3H10N4
and a molecular weight of 102.14 g/mol. Its IUPAC name is N-[amino(methyl)amino]-N'-methylmethanimidamide.
Molecular Properties
| Compound Name | N-[amino(methyl)amino]-N'-methylmethanimidamide |
| PubChem CID | 89241224 |
| Molecular Formula | C3H10N4 |
| Molecular Weight | 102.14 g/mol |
| Exact Mass | 102.09 |
| IUPAC Name | N-[amino(methyl)amino]-N'-methylmethanimidamide |
| SMILES | C/N=C/NN(C)N |
| InChI | InChI=1S/C3H10N4/c1-5-3-6-7(2)4/h3H,4H2,1-2H3,(H,5,6) |
| InChIKey | VUNMFMKFLQZCEE-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 102.14 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[amino(methyl)amino]-N'-methylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[amino(methyl)amino]-N'-methylmethanimidamide?
The IUPAC name of N-[amino(methyl)amino]-N'-methylmethanimidamide (CID 89241224) is N-[amino(methyl)amino]-N'-methylmethanimidamide.
What is the SMILES notation for N-[amino(methyl)amino]-N'-methylmethanimidamide?
The canonical SMILES for N-[amino(methyl)amino]-N'-methylmethanimidamide is C/N=C/NN(C)N.
What is the InChIKey of N-[amino(methyl)amino]-N'-methylmethanimidamide?
The InChIKey is VUNMFMKFLQZCEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H10N4/c1-5-3-6-7(2)4/h3H,4H2,1-2H3,(H,5,6).
What are the key properties of N-[amino(methyl)amino]-N'-methylmethanimidamide?
N-[amino(methyl)amino]-N'-methylmethanimidamide has a molecular weight of 102.14 g/mol, XLogP of -1.05, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[amino(methyl)amino]-N'-methylmethanimidamide is sourced from PubChem (CID 89241224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).