C33H52O5 — CID 89241267
(3Z,9S,11S)-11-hydroxy-7-[(E)-1-hydroxy-3-(3-methylcyclohexyl)prop-2-enyl]-9,10,15-trimethyl-13-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-3,19-dien-5-one (PubChem CID 89241267) has the molecular formula C33H52O5 and a molecular weight of 528.77 g/mol. Its IUPAC name is (3Z,9S,11S)-11-hydroxy-7-[(E)-1-hydroxy-3-(3-methylcyclohexyl)prop-2-enyl]-9,10,15-trimethyl-13-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-3,19-dien-5-one.
| Compound Name | (3Z,9S,11S)-11-hydroxy-7-[(E)-1-hydroxy-3-(3-methylcyclohexyl)prop-2-enyl]-9,10,15-trimethyl-13-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-3,19-dien-5-one |
|---|---|
| PubChem CID | 89241267 |
| Molecular Formula | C33H52O5 |
| Molecular Weight | 528.77 g/mol |
| Exact Mass | 528.38 |
| IUPAC Name | (3Z,9S,11S)-11-hydroxy-7-[(E)-1-hydroxy-3-(3-methylcyclohexyl)prop-2-enyl]-9,10,15-trimethyl-13-methylidene-6,21-dioxabicyclo[15.3.1]henicosa-3,19-dien-5-one |
| SMILES | C=C1CC(C)CC2CC=CC(C/C=C\C(=O)OC(C(O)/C=C/C3CCCC(C)C3)C[C@H](C)C(C)[C@@H](O)C1)O2 |
| InChI | InChI=1S/C33H52O5/c1-22-9-6-10-27(18-22)15-16-30(34)32-21-25(4)26(5)31(35)20-24(3)17-23(2)19-29-13-7-11-28(37-29)12-8-14-33(36)38-32/h7-8,11,14-16,22-23,25-32,34-35H,3,6,9-10,12-13,17-21H2,1-2,4-5H3/b14-8-,16-15+/t22?,23?,25-,26?,27?,28?,29?,30?,31-,32?/m0/s1 |
| InChIKey | RJIBELMEXMTVBI-QXYGVBJCSA-N |
| XLogP | 6.70 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.77 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|