About 1,3-dimethyl-7-oxabicyclo[2.2.1]hepta-2,5-diene-2-carbaldehyde
1,3-dimethyl-7-oxabicyclo[2.2.1]hepta-2,5-diene-2-carbaldehyde (PubChem CID 89241989) has the molecular formula C9H10O2
and a molecular weight of 150.18 g/mol. Its IUPAC name is 1,3-dimethyl-7-oxabicyclo[2.2.1]hepta-2,5-diene-2-carbaldehyde.
Molecular Properties
| Compound Name | 1,3-dimethyl-7-oxabicyclo[2.2.1]hepta-2,5-diene-2-carbaldehyde |
| PubChem CID | 89241989 |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | 1,3-dimethyl-7-oxabicyclo[2.2.1]hepta-2,5-diene-2-carbaldehyde |
| SMILES | CC1=C(C=O)C2(C)C=CC1O2 |
| InChI | InChI=1S/C9H10O2/c1-6-7(5-10)9(2)4-3-8(6)11-9/h3-5,8H,1-2H3 |
| InChIKey | GHLVYUAHMAXNCS-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dimethyl-7-oxabicyclo[2.2.1]hepta-2,5-diene-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-7-oxabicyclo[2.2.1]hepta-2,5-diene-2-carbaldehyde?
The IUPAC name of 1,3-dimethyl-7-oxabicyclo[2.2.1]hepta-2,5-diene-2-carbaldehyde (CID 89241989) is 1,3-dimethyl-7-oxabicyclo[2.2.1]hepta-2,5-diene-2-carbaldehyde.
What is the SMILES notation for 1,3-dimethyl-7-oxabicyclo[2.2.1]hepta-2,5-diene-2-carbaldehyde?
The canonical SMILES for 1,3-dimethyl-7-oxabicyclo[2.2.1]hepta-2,5-diene-2-carbaldehyde is CC1=C(C=O)C2(C)C=CC1O2.
What is the InChIKey of 1,3-dimethyl-7-oxabicyclo[2.2.1]hepta-2,5-diene-2-carbaldehyde?
The InChIKey is GHLVYUAHMAXNCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2/c1-6-7(5-10)9(2)4-3-8(6)11-9/h3-5,8H,1-2H3.
What are the key properties of 1,3-dimethyl-7-oxabicyclo[2.2.1]hepta-2,5-diene-2-carbaldehyde?
1,3-dimethyl-7-oxabicyclo[2.2.1]hepta-2,5-diene-2-carbaldehyde has a molecular weight of 150.18 g/mol, XLogP of 1.23, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-7-oxabicyclo[2.2.1]hepta-2,5-diene-2-carbaldehyde is sourced from PubChem (CID 89241989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).