C12H19F3N2O5 — CID 89242079
4-hydroxy-5-(hydroxymethyl)-N-[4-[(2,2,2-trifluoroacetyl)amino]butyl]oxolane-2-carboxamide (PubChem CID 89242079) has the molecular formula C12H19F3N2O5 and a molecular weight of 328.29 g/mol. Its IUPAC name is 4-hydroxy-5-(hydroxymethyl)-N-[4-[(2,2,2-trifluoroacetyl)amino]butyl]oxolane-2-carboxamide.
| Compound Name | 4-hydroxy-5-(hydroxymethyl)-N-[4-[(2,2,2-trifluoroacetyl)amino]butyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 89242079 |
| Molecular Formula | C12H19F3N2O5 |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 4-hydroxy-5-(hydroxymethyl)-N-[4-[(2,2,2-trifluoroacetyl)amino]butyl]oxolane-2-carboxamide |
| SMILES | O=C(NCCCCNC(=O)C(F)(F)F)C1CC(O)C(CO)O1 |
| InChI | InChI=1S/C12H19F3N2O5/c13-12(14,15)11(21)17-4-2-1-3-16-10(20)8-5-7(19)9(6-18)22-8/h7-9,18-19H,1-6H2,(H,16,20)(H,17,21) |
| InChIKey | XALQCLKOXCYQGL-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|