C33H47N3O5S2 — CID 89242105
(2R)-N-[(2R)-3-(cyclohexylmethylsulfanyl)-1-oxo-1-[(4-phenoxyphenyl)methylamino]propan-2-yl]-2-[2-(oxan-2-yloxy)ethylamino]-3-sulfanylpropanamide (PubChem CID 89242105) has the molecular formula C33H47N3O5S2 and a molecular weight of 629.89 g/mol. Its IUPAC name is (2R)-N-[(2R)-3-(cyclohexylmethylsulfanyl)-1-oxo-1-[(4-phenoxyphenyl)methylamino]propan-2-yl]-2-[2-(oxan-2-yloxy)ethylamino]-3-sulfanylpropanamide.
| Compound Name | (2R)-N-[(2R)-3-(cyclohexylmethylsulfanyl)-1-oxo-1-[(4-phenoxyphenyl)methylamino]propan-2-yl]-2-[2-(oxan-2-yloxy)ethylamino]-3-sulfanylpropanamide |
|---|---|
| PubChem CID | 89242105 |
| Molecular Formula | C33H47N3O5S2 |
| Molecular Weight | 629.89 g/mol |
| Exact Mass | 629.30 |
| IUPAC Name | (2R)-N-[(2R)-3-(cyclohexylmethylsulfanyl)-1-oxo-1-[(4-phenoxyphenyl)methylamino]propan-2-yl]-2-[2-(oxan-2-yloxy)ethylamino]-3-sulfanylpropanamide |
| SMILES | O=C(N[C@@H](CSCC1CCCCC1)C(=O)NCc1ccc(Oc2ccccc2)cc1)[C@H](CS)NCCOC1CCCCO1 |
| InChI | InChI=1S/C33H47N3O5S2/c37-32(35-21-25-14-16-28(17-15-25)41-27-11-5-2-6-12-27)30(24-43-23-26-9-3-1-4-10-26)36-33(38)29(22-42)34-18-20-40-31-13-7-8-19-39-31/h2,5-6,11-12,14-17,26,29-31,34,42H,1,3-4,7-10,13,18-24H2,(H,35,37)(H,36,38)/t29-,30-,31?/m0/s1 |
| InChIKey | KUKVYVQFOYZVOE-XPZBDPFPSA-N |
| XLogP | 5.32 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.89 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|