C18H25N3O3 — CID 89242111
5-[[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]methyl]-4,5-dihydro-1,2-oxazole-3-carbaldehyde (PubChem CID 89242111) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is 5-[[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]methyl]-4,5-dihydro-1,2-oxazole-3-carbaldehyde.
| Compound Name | 5-[[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]methyl]-4,5-dihydro-1,2-oxazole-3-carbaldehyde |
|---|---|
| PubChem CID | 89242111 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 5-[[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]methyl]-4,5-dihydro-1,2-oxazole-3-carbaldehyde |
| SMILES | CC(C)Oc1ccccc1N1CCN(CC2CC(C=O)=NO2)CC1 |
| InChI | InChI=1S/C18H25N3O3/c1-14(2)23-18-6-4-3-5-17(18)21-9-7-20(8-10-21)12-16-11-15(13-22)19-24-16/h3-6,13-14,16H,7-12H2,1-2H3 |
| InChIKey | IPMUYZXHEDIBMD-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 54.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|