C39H74O6 — CID 89242229
1-[8-(3-octyloxiran-2-yl)octanoyloxy]propan-2-yl 10-hydroxyoctadecanoate (PubChem CID 89242229) has the molecular formula C39H74O6 and a molecular weight of 639.02 g/mol. Its IUPAC name is 1-[8-(3-octyloxiran-2-yl)octanoyloxy]propan-2-yl 10-hydroxyoctadecanoate.
| Compound Name | 1-[8-(3-octyloxiran-2-yl)octanoyloxy]propan-2-yl 10-hydroxyoctadecanoate |
|---|---|
| PubChem CID | 89242229 |
| Molecular Formula | C39H74O6 |
| Molecular Weight | 639.02 g/mol |
| Exact Mass | 638.55 |
| IUPAC Name | 1-[8-(3-octyloxiran-2-yl)octanoyloxy]propan-2-yl 10-hydroxyoctadecanoate |
| SMILES | CCCCCCCCC(O)CCCCCCCCC(=O)OC(C)COC(=O)CCCCCCCC1OC1CCCCCCCC |
| InChI | InChI=1S/C39H74O6/c1-4-6-8-10-15-21-27-35(40)28-22-16-12-13-19-26-32-39(42)44-34(3)33-43-38(41)31-25-20-14-18-24-30-37-36(45-37)29-23-17-11-9-7-5-2/h34-37,40H,4-33H2,1-3H3 |
| InChIKey | RINGGLWBTGLSNM-UHFFFAOYSA-N |
| XLogP | 10.94 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.02 |
| LogP ≤ 5 | 10.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|