About [3-(cyclohexa-1,3-dien-1-ylmethyl)-1,2-dihydrotriazol-5-yl]methanamine
[3-(cyclohexa-1,3-dien-1-ylmethyl)-1,2-dihydrotriazol-5-yl]methanamine (PubChem CID 89242288) has the molecular formula C10H16N4
and a molecular weight of 192.27 g/mol. Its IUPAC name is [3-(cyclohexa-1,3-dien-1-ylmethyl)-1,2-dihydrotriazol-5-yl]methanamine.
Molecular Properties
| Compound Name | [3-(cyclohexa-1,3-dien-1-ylmethyl)-1,2-dihydrotriazol-5-yl]methanamine |
| PubChem CID | 89242288 |
| Molecular Formula | C10H16N4 |
| Molecular Weight | 192.27 g/mol |
| Exact Mass | 192.14 |
| IUPAC Name | [3-(cyclohexa-1,3-dien-1-ylmethyl)-1,2-dihydrotriazol-5-yl]methanamine |
| SMILES | NCC1=CN(CC2=CC=CCC2)NN1 |
| InChI | InChI=1S/C10H16N4/c11-6-10-8-14(13-12-10)7-9-4-2-1-3-5-9/h1-2,4,8,12-13H,3,5-7,11H2 |
| InChIKey | AOZRVLSMWXGRFZ-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.27 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-(cyclohexa-1,3-dien-1-ylmethyl)-1,2-dihydrotriazol-5-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(cyclohexa-1,3-dien-1-ylmethyl)-1,2-dihydrotriazol-5-yl]methanamine?
The IUPAC name of [3-(cyclohexa-1,3-dien-1-ylmethyl)-1,2-dihydrotriazol-5-yl]methanamine (CID 89242288) is [3-(cyclohexa-1,3-dien-1-ylmethyl)-1,2-dihydrotriazol-5-yl]methanamine.
What is the SMILES notation for [3-(cyclohexa-1,3-dien-1-ylmethyl)-1,2-dihydrotriazol-5-yl]methanamine?
The canonical SMILES for [3-(cyclohexa-1,3-dien-1-ylmethyl)-1,2-dihydrotriazol-5-yl]methanamine is NCC1=CN(CC2=CC=CCC2)NN1.
What is the InChIKey of [3-(cyclohexa-1,3-dien-1-ylmethyl)-1,2-dihydrotriazol-5-yl]methanamine?
The InChIKey is AOZRVLSMWXGRFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4/c11-6-10-8-14(13-12-10)7-9-4-2-1-3-5-9/h1-2,4,8,12-13H,3,5-7,11H2.
What are the key properties of [3-(cyclohexa-1,3-dien-1-ylmethyl)-1,2-dihydrotriazol-5-yl]methanamine?
[3-(cyclohexa-1,3-dien-1-ylmethyl)-1,2-dihydrotriazol-5-yl]methanamine has a molecular weight of 192.27 g/mol, XLogP of 0.39, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(cyclohexa-1,3-dien-1-ylmethyl)-1,2-dihydrotriazol-5-yl]methanamine is sourced from PubChem (CID 89242288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).