C30H44O7 — CID 89242370
(1R,7S,10S,15Z)-12-[(E)-3-(4,4-dimethyloxan-2-yl)-1-hydroxyprop-2-enyl]-7-hydroxy-5-methylidene-9,13,22-trioxatricyclo[16.3.1.08,10]docosa-15,19-dien-14-one (PubChem CID 89242370) has the molecular formula C30H44O7 and a molecular weight of 516.68 g/mol. Its IUPAC name is (1R,7S,10S,15Z)-12-[(E)-3-(4,4-dimethyloxan-2-yl)-1-hydroxyprop-2-enyl]-7-hydroxy-5-methylidene-9,13,22-trioxatricyclo[16.3.1.08,10]docosa-15,19-dien-14-one.
| Compound Name | (1R,7S,10S,15Z)-12-[(E)-3-(4,4-dimethyloxan-2-yl)-1-hydroxyprop-2-enyl]-7-hydroxy-5-methylidene-9,13,22-trioxatricyclo[16.3.1.08,10]docosa-15,19-dien-14-one |
|---|---|
| PubChem CID | 89242370 |
| Molecular Formula | C30H44O7 |
| Molecular Weight | 516.68 g/mol |
| Exact Mass | 516.31 |
| IUPAC Name | (1R,7S,10S,15Z)-12-[(E)-3-(4,4-dimethyloxan-2-yl)-1-hydroxyprop-2-enyl]-7-hydroxy-5-methylidene-9,13,22-trioxatricyclo[16.3.1.08,10]docosa-15,19-dien-14-one |
| SMILES | C=C1CCC[C@@H]2CC=CC(C/C=C/C(=O)OC(C(O)/C=C/C3CC(C)(C)CCO3)C[C@@H]3OC3[C@@H](O)C1)O2 |
| InChI | InChI=1S/C30H44O7/c1-20-7-4-8-21-9-5-10-22(35-21)11-6-12-28(33)36-26(18-27-29(37-27)25(32)17-20)24(31)14-13-23-19-30(2,3)15-16-34-23/h5-6,10,12-14,21-27,29,31-32H,1,4,7-9,11,15-19H2,2-3H3/b12-6+,14-13+/t21-,22?,23?,24?,25+,26?,27+,29?/m1/s1 |
| InChIKey | RARWBZZTCLKODG-UMUAHSOJSA-N |
| XLogP | 4.33 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.68 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|