C24H42O4Si — CID 89242400
(6E)-12-methyl-10-methylidene-13-[(2R)-6-(trimethylsilylmethyl)-3,6-dihydro-2H-pyran-2-yl]trideca-1,6-diene-3,4,8-triol (PubChem CID 89242400) has the molecular formula C24H42O4Si and a molecular weight of 422.68 g/mol. Its IUPAC name is (6E)-12-methyl-10-methylidene-13-[(2R)-6-(trimethylsilylmethyl)-3,6-dihydro-2H-pyran-2-yl]trideca-1,6-diene-3,4,8-triol.
| Compound Name | (6E)-12-methyl-10-methylidene-13-[(2R)-6-(trimethylsilylmethyl)-3,6-dihydro-2H-pyran-2-yl]trideca-1,6-diene-3,4,8-triol |
|---|---|
| PubChem CID | 89242400 |
| Molecular Formula | C24H42O4Si |
| Molecular Weight | 422.68 g/mol |
| Exact Mass | 422.29 |
| IUPAC Name | (6E)-12-methyl-10-methylidene-13-[(2R)-6-(trimethylsilylmethyl)-3,6-dihydro-2H-pyran-2-yl]trideca-1,6-diene-3,4,8-triol |
| SMILES | C=CC(O)C(O)C/C=C/C(O)CC(=C)CC(C)C[C@@H]1CC=CC(C[Si](C)(C)C)O1 |
| InChI | InChI=1S/C24H42O4Si/c1-7-23(26)24(27)13-8-10-20(25)15-18(2)14-19(3)16-21-11-9-12-22(28-21)17-29(4,5)6/h7-10,12,19-27H,1-2,11,13-17H2,3-6H3/b10-8+/t19?,20?,21-,22?,23?,24?/m0/s1 |
| InChIKey | XVGWNTCGAOAGSX-GGQUYIESSA-N |
| XLogP | 4.62 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.68 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|