C30H44O6 — CID 89242401
(1R,10S,15Z)-12-[(E)-3-cyclohexyl-1-hydroxyprop-2-enyl]-7-hydroxy-3-methyl-5-methylidene-9,13,22-trioxatricyclo[16.3.1.08,10]docosa-15,19-dien-14-one (PubChem CID 89242401) has the molecular formula C30H44O6 and a molecular weight of 500.68 g/mol. Its IUPAC name is (1R,10S,15Z)-12-[(E)-3-cyclohexyl-1-hydroxyprop-2-enyl]-7-hydroxy-3-methyl-5-methylidene-9,13,22-trioxatricyclo[16.3.1.08,10]docosa-15,19-dien-14-one.
| Compound Name | (1R,10S,15Z)-12-[(E)-3-cyclohexyl-1-hydroxyprop-2-enyl]-7-hydroxy-3-methyl-5-methylidene-9,13,22-trioxatricyclo[16.3.1.08,10]docosa-15,19-dien-14-one |
|---|---|
| PubChem CID | 89242401 |
| Molecular Formula | C30H44O6 |
| Molecular Weight | 500.68 g/mol |
| Exact Mass | 500.31 |
| IUPAC Name | (1R,10S,15Z)-12-[(E)-3-cyclohexyl-1-hydroxyprop-2-enyl]-7-hydroxy-3-methyl-5-methylidene-9,13,22-trioxatricyclo[16.3.1.08,10]docosa-15,19-dien-14-one |
| SMILES | C=C1CC(C)C[C@@H]2CC=CC(C/C=C/C(=O)OC(C(O)/C=C/C3CCCCC3)C[C@@H]3OC3C(O)C1)O2 |
| InChI | InChI=1S/C30H44O6/c1-20-16-21(2)18-26(32)30-28(36-30)19-27(25(31)15-14-22-8-4-3-5-9-22)35-29(33)13-7-11-23-10-6-12-24(17-20)34-23/h6-7,10,13-15,20,22-28,30-32H,2-5,8-9,11-12,16-19H2,1H3/b13-7+,15-14+/t20?,23?,24-,25?,26?,27?,28-,30?/m0/s1 |
| InChIKey | RGPSWEFSOAIUAD-QIBYQPINSA-N |
| XLogP | 4.95 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.68 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|