About 8-(fluoromethoxy)-2,6-dimethyl-3,4-dihydro-2H-chromene-7-carbonyl fluoride
8-(fluoromethoxy)-2,6-dimethyl-3,4-dihydro-2H-chromene-7-carbonyl fluoride (PubChem CID 89242607) has the molecular formula C13H14F2O3
and a molecular weight of 256.25 g/mol. Its IUPAC name is 8-(fluoromethoxy)-2,6-dimethyl-3,4-dihydro-2H-chromene-7-carbonyl fluoride.
Molecular Properties
| Compound Name | 8-(fluoromethoxy)-2,6-dimethyl-3,4-dihydro-2H-chromene-7-carbonyl fluoride |
| PubChem CID | 89242607 |
| Molecular Formula | C13H14F2O3 |
| Molecular Weight | 256.25 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 8-(fluoromethoxy)-2,6-dimethyl-3,4-dihydro-2H-chromene-7-carbonyl fluoride |
| SMILES | Cc1cc2c(c(OCF)c1C(=O)F)OC(C)CC2 |
| InChI | InChI=1S/C13H14F2O3/c1-7-5-9-4-3-8(2)18-11(9)12(17-6-14)10(7)13(15)16/h5,8H,3-4,6H2,1-2H3 |
| InChIKey | YPDSHFWEWANEMS-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.25 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 8-(fluoromethoxy)-2,6-dimethyl-3,4-dihydro-2H-chromene-7-carbonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(fluoromethoxy)-2,6-dimethyl-3,4-dihydro-2H-chromene-7-carbonyl fluoride?
The IUPAC name of 8-(fluoromethoxy)-2,6-dimethyl-3,4-dihydro-2H-chromene-7-carbonyl fluoride (CID 89242607) is 8-(fluoromethoxy)-2,6-dimethyl-3,4-dihydro-2H-chromene-7-carbonyl fluoride.
What is the SMILES notation for 8-(fluoromethoxy)-2,6-dimethyl-3,4-dihydro-2H-chromene-7-carbonyl fluoride?
The canonical SMILES for 8-(fluoromethoxy)-2,6-dimethyl-3,4-dihydro-2H-chromene-7-carbonyl fluoride is Cc1cc2c(c(OCF)c1C(=O)F)OC(C)CC2.
What is the InChIKey of 8-(fluoromethoxy)-2,6-dimethyl-3,4-dihydro-2H-chromene-7-carbonyl fluoride?
The InChIKey is YPDSHFWEWANEMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14F2O3/c1-7-5-9-4-3-8(2)18-11(9)12(17-6-14)10(7)13(15)16/h5,8H,3-4,6H2,1-2H3.
What are the key properties of 8-(fluoromethoxy)-2,6-dimethyl-3,4-dihydro-2H-chromene-7-carbonyl fluoride?
8-(fluoromethoxy)-2,6-dimethyl-3,4-dihydro-2H-chromene-7-carbonyl fluoride has a molecular weight of 256.25 g/mol, XLogP of 3.12, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(fluoromethoxy)-2,6-dimethyl-3,4-dihydro-2H-chromene-7-carbonyl fluoride is sourced from PubChem (CID 89242607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).