C37H51FN4O2 — CID 89242886
(1R,2S,5S,6R,15R)-18-amino-12-(4-amino-3-fluorophenyl)-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-6-carboxylic acid (PubChem CID 89242886) has the molecular formula C37H51FN4O2 and a molecular weight of 602.84 g/mol. Its IUPAC name is (1R,2S,5S,6R,15R)-18-amino-12-(4-amino-3-fluorophenyl)-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-6-carboxylic acid.
| Compound Name | (1R,2S,5S,6R,15R)-18-amino-12-(4-amino-3-fluorophenyl)-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-6-carboxylic acid |
|---|---|
| PubChem CID | 89242886 |
| Molecular Formula | C37H51FN4O2 |
| Molecular Weight | 602.84 g/mol |
| Exact Mass | 602.40 |
| IUPAC Name | (1R,2S,5S,6R,15R)-18-amino-12-(4-amino-3-fluorophenyl)-1,2,8,8,15,22,22-heptamethyl-19,20-diazahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-11,17(21),18-triene-6-carboxylic acid |
| SMILES | CC1(C)CC2C3=C(c4ccc(N)c(F)c4)CC4[C@@]5(C)Cc6c(N)n[nH]c6C(C)(C)C5CC[C@@]4(C)[C@]3(C)CC[C@@H]2[C@H](C(=O)O)C1 |
| InChI | InChI=1S/C37H51FN4O2/c1-33(2)16-22-20(23(17-33)32(43)44)10-12-37(7)29(22)21(19-8-9-26(39)25(38)14-19)15-28-35(5)18-24-30(41-42-31(24)40)34(3,4)27(35)11-13-36(28,37)6/h8-9,14,20,22-23,27-28H,10-13,15-18,39H2,1-7H3,(H,43,44)(H3,40,41,42)/t20-,22?,23+,27?,28?,35-,36+,37+/m0/s1 |
| InChIKey | MZBNWDFCPDCSRO-LOXGCSGJSA-N |
| XLogP | 8.00 |
| TPSA | 118.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.84 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|