About (3Z)-3-(cyclohexylamino)-4-piperazin-1-ylhexa-3,5-dien-2-one
(3Z)-3-(cyclohexylamino)-4-piperazin-1-ylhexa-3,5-dien-2-one (PubChem CID 89243332) has the molecular formula C16H27N3O
and a molecular weight of 277.41 g/mol. Its IUPAC name is (3Z)-3-(cyclohexylamino)-4-piperazin-1-ylhexa-3,5-dien-2-one.
Molecular Properties
| Compound Name | (3Z)-3-(cyclohexylamino)-4-piperazin-1-ylhexa-3,5-dien-2-one |
| PubChem CID | 89243332 |
| Molecular Formula | C16H27N3O |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | (3Z)-3-(cyclohexylamino)-4-piperazin-1-ylhexa-3,5-dien-2-one |
| SMILES | C=C/C(=C(/NC1CCCCC1)C(C)=O)N1CCNCC1 |
| InChI | InChI=1S/C16H27N3O/c1-3-15(19-11-9-17-10-12-19)16(13(2)20)18-14-7-5-4-6-8-14/h3,14,17-18H,1,4-12H2,2H3/b16-15- |
| InChIKey | ORQZPYSCEWICOF-NXVVXOECSA-N |
| XLogP | 1.80 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-3-(cyclohexylamino)-4-piperazin-1-ylhexa-3,5-dien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-(cyclohexylamino)-4-piperazin-1-ylhexa-3,5-dien-2-one?
The IUPAC name of (3Z)-3-(cyclohexylamino)-4-piperazin-1-ylhexa-3,5-dien-2-one (CID 89243332) is (3Z)-3-(cyclohexylamino)-4-piperazin-1-ylhexa-3,5-dien-2-one.
What is the SMILES notation for (3Z)-3-(cyclohexylamino)-4-piperazin-1-ylhexa-3,5-dien-2-one?
The canonical SMILES for (3Z)-3-(cyclohexylamino)-4-piperazin-1-ylhexa-3,5-dien-2-one is C=C/C(=C(/NC1CCCCC1)C(C)=O)N1CCNCC1.
What is the InChIKey of (3Z)-3-(cyclohexylamino)-4-piperazin-1-ylhexa-3,5-dien-2-one?
The InChIKey is ORQZPYSCEWICOF-NXVVXOECSA-N. The full InChI is InChI=1S/C16H27N3O/c1-3-15(19-11-9-17-10-12-19)16(13(2)20)18-14-7-5-4-6-8-14/h3,14,17-18H,1,4-12H2,2H3/b16-15-.
What are the key properties of (3Z)-3-(cyclohexylamino)-4-piperazin-1-ylhexa-3,5-dien-2-one?
(3Z)-3-(cyclohexylamino)-4-piperazin-1-ylhexa-3,5-dien-2-one has a molecular weight of 277.41 g/mol, XLogP of 1.80, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-(cyclohexylamino)-4-piperazin-1-ylhexa-3,5-dien-2-one is sourced from PubChem (CID 89243332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).