About (2S,4R)-2,4-dimethyl-6-methylideneoxane
(2S,4R)-2,4-dimethyl-6-methylideneoxane (PubChem CID 89243381) has the molecular formula C8H14O
and a molecular weight of 126.20 g/mol. Its IUPAC name is (2S,4R)-2,4-dimethyl-6-methylideneoxane.
Molecular Properties
| Compound Name | (2S,4R)-2,4-dimethyl-6-methylideneoxane |
| PubChem CID | 89243381 |
| Molecular Formula | C8H14O |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.10 |
| IUPAC Name | (2S,4R)-2,4-dimethyl-6-methylideneoxane |
| SMILES | C=C1C[C@H](C)C[C@H](C)O1 |
| InChI | InChI=1S/C8H14O/c1-6-4-7(2)9-8(3)5-6/h6,8H,2,4-5H2,1,3H3/t6-,8-/m0/s1 |
| InChIKey | DOMNSOYKYIWYRD-XPUUQOCRSA-N |
| XLogP | 2.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S,4R)-2,4-dimethyl-6-methylideneoxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,4R)-2,4-dimethyl-6-methylideneoxane?
The IUPAC name of (2S,4R)-2,4-dimethyl-6-methylideneoxane (CID 89243381) is (2S,4R)-2,4-dimethyl-6-methylideneoxane.
What is the SMILES notation for (2S,4R)-2,4-dimethyl-6-methylideneoxane?
The canonical SMILES for (2S,4R)-2,4-dimethyl-6-methylideneoxane is C=C1C[C@H](C)C[C@H](C)O1.
What is the InChIKey of (2S,4R)-2,4-dimethyl-6-methylideneoxane?
The InChIKey is DOMNSOYKYIWYRD-XPUUQOCRSA-N. The full InChI is InChI=1S/C8H14O/c1-6-4-7(2)9-8(3)5-6/h6,8H,2,4-5H2,1,3H3/t6-,8-/m0/s1.
What are the key properties of (2S,4R)-2,4-dimethyl-6-methylideneoxane?
(2S,4R)-2,4-dimethyl-6-methylideneoxane has a molecular weight of 126.20 g/mol, XLogP of 2.34, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,4R)-2,4-dimethyl-6-methylideneoxane is sourced from PubChem (CID 89243381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).