C16H17FN4O2 — CID 89243385
(5S)-5-(azidomethyl)-3-[4-[(1S,2S)-2-(fluoromethyl)-1-methoxybut-3-ynyl]phenyl]-4,5-dihydro-1,2-oxazole (PubChem CID 89243385) has the molecular formula C16H17FN4O2 and a molecular weight of 316.34 g/mol. Its IUPAC name is (5S)-5-(azidomethyl)-3-[4-[(1S,2S)-2-(fluoromethyl)-1-methoxybut-3-ynyl]phenyl]-4,5-dihydro-1,2-oxazole.
| Compound Name | (5S)-5-(azidomethyl)-3-[4-[(1S,2S)-2-(fluoromethyl)-1-methoxybut-3-ynyl]phenyl]-4,5-dihydro-1,2-oxazole |
|---|---|
| PubChem CID | 89243385 |
| Molecular Formula | C16H17FN4O2 |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | (5S)-5-(azidomethyl)-3-[4-[(1S,2S)-2-(fluoromethyl)-1-methoxybut-3-ynyl]phenyl]-4,5-dihydro-1,2-oxazole |
| SMILES | C#C[C@H](CF)[C@H](OC)c1ccc(C2=NO[C@H](CN=[N+]=[N-])C2)cc1 |
| InChI | InChI=1S/C16H17FN4O2/c1-3-11(9-17)16(22-2)13-6-4-12(5-7-13)15-8-14(23-20-15)10-19-21-18/h1,4-7,11,14,16H,8-10H2,2H3/t11-,14+,16+/m1/s1 |
| InChIKey | QPNYUPFVKARXCQ-WPGHFRTFSA-N |
| XLogP | 3.40 |
| TPSA | 79.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|