C10H7F6O4S- — CID 89243409
2,5-bis(2,2,2-trifluoroethoxy)benzenesulfinate (PubChem CID 89243409) has the molecular formula C10H7F6O4S- and a molecular weight of 337.22 g/mol. Its IUPAC name is 2,5-bis(2,2,2-trifluoroethoxy)benzenesulfinate.
| Compound Name | 2,5-bis(2,2,2-trifluoroethoxy)benzenesulfinate |
|---|---|
| PubChem CID | 89243409 |
| Molecular Formula | C10H7F6O4S- |
| Molecular Weight | 337.22 g/mol |
| Exact Mass | 337.00 |
| IUPAC Name | 2,5-bis(2,2,2-trifluoroethoxy)benzenesulfinate |
| SMILES | O=S([O-])c1cc(OCC(F)(F)F)ccc1OCC(F)(F)F |
| InChI | InChI=1S/C10H8F6O4S/c11-9(12,13)4-19-6-1-2-7(8(3-6)21(17)18)20-5-10(14,15)16/h1-3H,4-5H2,(H,17,18)/p-1 |
| InChIKey | SQKWIRYDVSNBKI-UHFFFAOYSA-M |
| XLogP | 2.81 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.22 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|