About 4-fluoro-6-methylcyclohexa-2,4-diene-1-sulfinate
4-fluoro-6-methylcyclohexa-2,4-diene-1-sulfinate (PubChem CID 89243418) has the molecular formula C7H8FO2S-
and a molecular weight of 175.20 g/mol. Its IUPAC name is 4-fluoro-6-methylcyclohexa-2,4-diene-1-sulfinate.
Molecular Properties
| Compound Name | 4-fluoro-6-methylcyclohexa-2,4-diene-1-sulfinate |
| PubChem CID | 89243418 |
| Molecular Formula | C7H8FO2S- |
| Molecular Weight | 175.20 g/mol |
| Exact Mass | 175.02 |
| IUPAC Name | 4-fluoro-6-methylcyclohexa-2,4-diene-1-sulfinate |
| SMILES | CC1C=C(F)C=CC1S(=O)[O-] |
| InChI | InChI=1S/C7H9FO2S/c1-5-4-6(8)2-3-7(5)11(9)10/h2-5,7H,1H3,(H,9,10)/p-1 |
| InChIKey | GEEAFPQYZLFMNU-UHFFFAOYSA-M |
| XLogP | 1.29 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.20 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 4-fluoro-6-methylcyclohexa-2,4-diene-1-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-6-methylcyclohexa-2,4-diene-1-sulfinate?
The IUPAC name of 4-fluoro-6-methylcyclohexa-2,4-diene-1-sulfinate (CID 89243418) is 4-fluoro-6-methylcyclohexa-2,4-diene-1-sulfinate.
What is the SMILES notation for 4-fluoro-6-methylcyclohexa-2,4-diene-1-sulfinate?
The canonical SMILES for 4-fluoro-6-methylcyclohexa-2,4-diene-1-sulfinate is CC1C=C(F)C=CC1S(=O)[O-].
What is the InChIKey of 4-fluoro-6-methylcyclohexa-2,4-diene-1-sulfinate?
The InChIKey is GEEAFPQYZLFMNU-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H9FO2S/c1-5-4-6(8)2-3-7(5)11(9)10/h2-5,7H,1H3,(H,9,10)/p-1.
What are the key properties of 4-fluoro-6-methylcyclohexa-2,4-diene-1-sulfinate?
4-fluoro-6-methylcyclohexa-2,4-diene-1-sulfinate has a molecular weight of 175.20 g/mol, XLogP of 1.29, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-6-methylcyclohexa-2,4-diene-1-sulfinate is sourced from PubChem (CID 89243418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).