About 4,5-dihydro-1H-thieno[3,2-d]pyrazole-5-carbonitrile
4,5-dihydro-1H-thieno[3,2-d]pyrazole-5-carbonitrile (PubChem CID 89244229) has the molecular formula C6H5N3S
and a molecular weight of 151.19 g/mol. Its IUPAC name is 4,5-dihydro-1H-thieno[3,2-d]pyrazole-5-carbonitrile.
Molecular Properties
| Compound Name | 4,5-dihydro-1H-thieno[3,2-d]pyrazole-5-carbonitrile |
| PubChem CID | 89244229 |
| Molecular Formula | C6H5N3S |
| Molecular Weight | 151.19 g/mol |
| Exact Mass | 151.02 |
| IUPAC Name | 4,5-dihydro-1H-thieno[3,2-d]pyrazole-5-carbonitrile |
| SMILES | N#CC1Cc2cn[nH]c2S1 |
| InChI | InChI=1S/C6H5N3S/c7-2-5-1-4-3-8-9-6(4)10-5/h3,5H,1H2,(H,8,9) |
| InChIKey | JSXOTUDLNAGIKS-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.19 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,5-dihydro-1H-thieno[3,2-d]pyrazole-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dihydro-1H-thieno[3,2-d]pyrazole-5-carbonitrile?
The IUPAC name of 4,5-dihydro-1H-thieno[3,2-d]pyrazole-5-carbonitrile (CID 89244229) is 4,5-dihydro-1H-thieno[3,2-d]pyrazole-5-carbonitrile.
What is the SMILES notation for 4,5-dihydro-1H-thieno[3,2-d]pyrazole-5-carbonitrile?
The canonical SMILES for 4,5-dihydro-1H-thieno[3,2-d]pyrazole-5-carbonitrile is N#CC1Cc2cn[nH]c2S1.
What is the InChIKey of 4,5-dihydro-1H-thieno[3,2-d]pyrazole-5-carbonitrile?
The InChIKey is JSXOTUDLNAGIKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3S/c7-2-5-1-4-3-8-9-6(4)10-5/h3,5H,1H2,(H,8,9).
What are the key properties of 4,5-dihydro-1H-thieno[3,2-d]pyrazole-5-carbonitrile?
4,5-dihydro-1H-thieno[3,2-d]pyrazole-5-carbonitrile has a molecular weight of 151.19 g/mol, XLogP of 0.95, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dihydro-1H-thieno[3,2-d]pyrazole-5-carbonitrile is sourced from PubChem (CID 89244229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).