C11H10FN3 — CID 89244422
(2E,4E,6E)-6-fluoro-4-(1H-imidazol-5-yl)octa-2,4,6-trienenitrile (PubChem CID 89244422) has the molecular formula C11H10FN3 and a molecular weight of 203.22 g/mol. Its IUPAC name is (2E,4E,6E)-6-fluoro-4-(1H-imidazol-5-yl)octa-2,4,6-trienenitrile.
| Compound Name | (2E,4E,6E)-6-fluoro-4-(1H-imidazol-5-yl)octa-2,4,6-trienenitrile |
|---|---|
| PubChem CID | 89244422 |
| Molecular Formula | C11H10FN3 |
| Molecular Weight | 203.22 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | (2E,4E,6E)-6-fluoro-4-(1H-imidazol-5-yl)octa-2,4,6-trienenitrile |
| SMILES | C/C=C(F)\C=C(/C=C/C#N)c1cnc[nH]1 |
| InChI | InChI=1S/C11H10FN3/c1-2-10(12)6-9(4-3-5-13)11-7-14-8-15-11/h2-4,6-8H,1H3,(H,14,15)/b4-3+,9-6+,10-2+ |
| InChIKey | KAJOZRAMOQLVEQ-HYEJGNGFSA-N |
| XLogP | 2.75 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.22 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|