About (Z)-3,3-dimethyl-1-(3-methylhexan-3-ylsulfanyl)hex-1-ene
(Z)-3,3-dimethyl-1-(3-methylhexan-3-ylsulfanyl)hex-1-ene (PubChem CID 89244423) has the molecular formula C15H30S
and a molecular weight of 242.47 g/mol. Its IUPAC name is (Z)-3,3-dimethyl-1-(3-methylhexan-3-ylsulfanyl)hex-1-ene.
Molecular Properties
| Compound Name | (Z)-3,3-dimethyl-1-(3-methylhexan-3-ylsulfanyl)hex-1-ene |
| PubChem CID | 89244423 |
| Molecular Formula | C15H30S |
| Molecular Weight | 242.47 g/mol |
| Exact Mass | 242.21 |
| IUPAC Name | (Z)-3,3-dimethyl-1-(3-methylhexan-3-ylsulfanyl)hex-1-ene |
| SMILES | CCCC(C)(C)/C=C\SC(C)(CC)CCC |
| InChI | InChI=1S/C15H30S/c1-7-10-14(4,5)12-13-16-15(6,9-3)11-8-2/h12-13H,7-11H2,1-6H3/b13-12- |
| InChIKey | GCPMGJMUGSHVHQ-SEYXRHQNSA-N |
| XLogP | 6.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 242.47 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (Z)-3,3-dimethyl-1-(3-methylhexan-3-ylsulfanyl)hex-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3,3-dimethyl-1-(3-methylhexan-3-ylsulfanyl)hex-1-ene?
The IUPAC name of (Z)-3,3-dimethyl-1-(3-methylhexan-3-ylsulfanyl)hex-1-ene (CID 89244423) is (Z)-3,3-dimethyl-1-(3-methylhexan-3-ylsulfanyl)hex-1-ene.
What is the SMILES notation for (Z)-3,3-dimethyl-1-(3-methylhexan-3-ylsulfanyl)hex-1-ene?
The canonical SMILES for (Z)-3,3-dimethyl-1-(3-methylhexan-3-ylsulfanyl)hex-1-ene is CCCC(C)(C)/C=C\SC(C)(CC)CCC.
What is the InChIKey of (Z)-3,3-dimethyl-1-(3-methylhexan-3-ylsulfanyl)hex-1-ene?
The InChIKey is GCPMGJMUGSHVHQ-SEYXRHQNSA-N. The full InChI is InChI=1S/C15H30S/c1-7-10-14(4,5)12-13-16-15(6,9-3)11-8-2/h12-13H,7-11H2,1-6H3/b13-12-.
What are the key properties of (Z)-3,3-dimethyl-1-(3-methylhexan-3-ylsulfanyl)hex-1-ene?
(Z)-3,3-dimethyl-1-(3-methylhexan-3-ylsulfanyl)hex-1-ene has a molecular weight of 242.47 g/mol, XLogP of 6.03, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3,3-dimethyl-1-(3-methylhexan-3-ylsulfanyl)hex-1-ene is sourced from PubChem (CID 89244423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).