About 2-ethyl-1,3,5-triiodo-4-methoxybenzene
2-ethyl-1,3,5-triiodo-4-methoxybenzene (PubChem CID 89244561) has the molecular formula C9H9I3O
and a molecular weight of 513.88 g/mol. Its IUPAC name is 2-ethyl-1,3,5-triiodo-4-methoxybenzene.
Molecular Properties
| Compound Name | 2-ethyl-1,3,5-triiodo-4-methoxybenzene |
| PubChem CID | 89244561 |
| Molecular Formula | C9H9I3O |
| Molecular Weight | 513.88 g/mol |
| Exact Mass | 513.78 |
| IUPAC Name | 2-ethyl-1,3,5-triiodo-4-methoxybenzene |
| SMILES | CCc1c(I)cc(I)c(OC)c1I |
| InChI | InChI=1S/C9H9I3O/c1-3-5-6(10)4-7(11)9(13-2)8(5)12/h4H,3H2,1-2H3 |
| InChIKey | PRSKSJHKBCJMGQ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 513.88 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-1,3,5-triiodo-4-methoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-1,3,5-triiodo-4-methoxybenzene?
The IUPAC name of 2-ethyl-1,3,5-triiodo-4-methoxybenzene (CID 89244561) is 2-ethyl-1,3,5-triiodo-4-methoxybenzene.
What is the SMILES notation for 2-ethyl-1,3,5-triiodo-4-methoxybenzene?
The canonical SMILES for 2-ethyl-1,3,5-triiodo-4-methoxybenzene is CCc1c(I)cc(I)c(OC)c1I.
What is the InChIKey of 2-ethyl-1,3,5-triiodo-4-methoxybenzene?
The InChIKey is PRSKSJHKBCJMGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9I3O/c1-3-5-6(10)4-7(11)9(13-2)8(5)12/h4H,3H2,1-2H3.
What are the key properties of 2-ethyl-1,3,5-triiodo-4-methoxybenzene?
2-ethyl-1,3,5-triiodo-4-methoxybenzene has a molecular weight of 513.88 g/mol, XLogP of 4.07, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1,3,5-triiodo-4-methoxybenzene is sourced from PubChem (CID 89244561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).