C25H20N2O5 — CID 89244582
5-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-12H-quinolino[2,3-b]acridine-7,14-dione (PubChem CID 89244582) has the molecular formula C25H20N2O5 and a molecular weight of 428.44 g/mol. Its IUPAC name is 5-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-12H-quinolino[2,3-b]acridine-7,14-dione.
| Compound Name | 5-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-12H-quinolino[2,3-b]acridine-7,14-dione |
|---|---|
| PubChem CID | 89244582 |
| Molecular Formula | C25H20N2O5 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | 5-[(2R,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-12H-quinolino[2,3-b]acridine-7,14-dione |
| SMILES | O=c1c2ccccc2[nH]c2cc3c(=O)c4ccccc4n([C@H]4CC(O)[C@@H](CO)O4)c3cc12 |
| InChI | InChI=1S/C25H20N2O5/c28-12-22-21(29)11-23(32-22)27-19-8-4-2-6-14(19)25(31)16-9-18-15(10-20(16)27)24(30)13-5-1-3-7-17(13)26-18/h1-10,21-23,28-29H,11-12H2,(H,26,30)/t21?,22-,23-/m1/s1 |
| InChIKey | NCTKWKCMWHGCLA-XMCWYHTOSA-N |
| XLogP | 2.79 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|