C12H16F6O — CID 89244640
2-[(4-ethenyl-2-methylcyclopentyl)methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 89244640) has the molecular formula C12H16F6O and a molecular weight of 290.25 g/mol. Its IUPAC name is 2-[(4-ethenyl-2-methylcyclopentyl)methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[(4-ethenyl-2-methylcyclopentyl)methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 89244640 |
| Molecular Formula | C12H16F6O |
| Molecular Weight | 290.25 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 2-[(4-ethenyl-2-methylcyclopentyl)methyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | C=CC1CC(C)C(CC(O)(C(F)(F)F)C(F)(F)F)C1 |
| InChI | InChI=1S/C12H16F6O/c1-3-8-4-7(2)9(5-8)6-10(19,11(13,14)15)12(16,17)18/h3,7-9,19H,1,4-6H2,2H3 |
| InChIKey | UZLMNLGUBFFOGM-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.25 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|