C34H36Cl2FN3O3 — CID 89244707
1-(2,4-dichlorophenyl)-4-[6-(4-fluorophenyl)hexyl]-N-[(2R)-1-(4-hydroxyphenyl)-3-methoxybut-3-en-2-yl]-5-methylpyrazole-3-carboxamide (PubChem CID 89244707) has the molecular formula C34H36Cl2FN3O3 and a molecular weight of 624.58 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-4-[6-(4-fluorophenyl)hexyl]-N-[(2R)-1-(4-hydroxyphenyl)-3-methoxybut-3-en-2-yl]-5-methylpyrazole-3-carboxamide.
| Compound Name | 1-(2,4-dichlorophenyl)-4-[6-(4-fluorophenyl)hexyl]-N-[(2R)-1-(4-hydroxyphenyl)-3-methoxybut-3-en-2-yl]-5-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 89244707 |
| Molecular Formula | C34H36Cl2FN3O3 |
| Molecular Weight | 624.58 g/mol |
| Exact Mass | 623.21 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-4-[6-(4-fluorophenyl)hexyl]-N-[(2R)-1-(4-hydroxyphenyl)-3-methoxybut-3-en-2-yl]-5-methylpyrazole-3-carboxamide |
| SMILES | C=C(OC)[C@@H](Cc1ccc(O)cc1)NC(=O)c1nn(-c2ccc(Cl)cc2Cl)c(C)c1CCCCCCc1ccc(F)cc1 |
| InChI | InChI=1S/C34H36Cl2FN3O3/c1-22-29(9-7-5-4-6-8-24-10-15-27(37)16-11-24)33(39-40(22)32-19-14-26(35)21-30(32)36)34(42)38-31(23(2)43-3)20-25-12-17-28(41)18-13-25/h10-19,21,31,41H,2,4-9,20H2,1,3H3,(H,38,42)/t31-/m1/s1 |
| InChIKey | RCTCYPPCQQKULQ-WJOKGBTCSA-N |
| XLogP | 8.18 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.58 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|